ChemNet > CAS > 52239-63-1 malic acid, compound with 2-(ethylthio)-10-[3-(4-methylpiperazin-1-yl)propyl]-10H-phenothiazine (2:1)
52239-63-1 malic acid, compound with 2-(ethylthio)-10-[3-(4-methylpiperazin-1-yl)propyl]-10H-phenothiazine (2:1)
상품명칭 |
malic acid, compound with 2-(ethylthio)-10-[3-(4-methylpiperazin-1-yl)propyl]-10H-phenothiazine (2:1) |
영문 이름 |
malic acid, compound with 2-(ethylthio)-10-[3-(4-methylpiperazin-1-yl)propyl]-10H-phenothiazine (2:1); Thiethylperazine Malate; 2-hydroxybutanedioic acid - 2-(ethylsulfanyl)-10-[3-(4-methylpiperazin-1-yl)propyl]-10H-phenothiazine (2:1) |
분자식 |
C30H41N3O10S2 |
분자량 |
667.7906 |
InChI |
InChI=1/C22H29N3S2.2C4H6O5/c1-3-26-18-9-10-22-20(17-18)25(19-7-4-5-8-21(19)27-22)12-6-11-24-15-13-23(2)14-16-24;2*5-2(4(8)9)1-3(6)7/h4-5,7-10,17H,3,6,11-16H2,1-2H3;2*2,5H,1H2,(H,6,7)(H,8,9) |
cas번호 |
52239-63-1 |
EC번호 |
257-780-2 |
분자 구조 |
|
비등점 |
559.8°C at 760 mmHg |
인화점 |
292.4°C |
증기압 |
1.46E-12mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|